C25H31FN4 — CID 142836344
3-N-[1-[4-amino-2-butyl-3-[(E)-3-(4-fluorophenyl)prop-2-enimidoyl]phenyl]ethenyl]but-1-ene-2,3-diamine (PubChem CID 142836344) has the molecular formula C25H31FN4 and a molecular weight of 406.55 g/mol. Its IUPAC name is 3-N-[1-[4-amino-2-butyl-3-[(E)-3-(4-fluorophenyl)prop-2-enimidoyl]phenyl]ethenyl]but-1-ene-2,3-diamine.
| Compound Name | 3-N-[1-[4-amino-2-butyl-3-[(E)-3-(4-fluorophenyl)prop-2-enimidoyl]phenyl]ethenyl]but-1-ene-2,3-diamine |
|---|---|
| PubChem CID | 142836344 |
| Molecular Formula | C25H31FN4 |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | 3-N-[1-[4-amino-2-butyl-3-[(E)-3-(4-fluorophenyl)prop-2-enimidoyl]phenyl]ethenyl]but-1-ene-2,3-diamine |
| SMILES | [H]/N=C(\C=C\c1ccc(F)cc1)c1c(N)ccc(C(=C)NC(C)C(=C)N)c1CCCC |
| InChI | InChI=1S/C25H31FN4/c1-5-6-7-22-21(18(4)30-17(3)16(2)27)13-15-24(29)25(22)23(28)14-10-19-8-11-20(26)12-9-19/h8-15,17,28,30H,2,4-7,27,29H2,1,3H3/b14-10+,28-23+ |
| InChIKey | JOWLCIOOCJWRDN-APPWEACSSA-N |
| XLogP | 5.25 |
| TPSA | 87.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|