C22H27FN4O2 — CID 142836518
4-amino-N-[3-(dimethylamino)propyl]-3-[(E)-3-(4-fluorophenyl)prop-2-enimidoyl]-2-methoxybenzamide (PubChem CID 142836518) has the molecular formula C22H27FN4O2 and a molecular weight of 398.48 g/mol. Its IUPAC name is 4-amino-N-[3-(dimethylamino)propyl]-3-[(E)-3-(4-fluorophenyl)prop-2-enimidoyl]-2-methoxybenzamide.
| Compound Name | 4-amino-N-[3-(dimethylamino)propyl]-3-[(E)-3-(4-fluorophenyl)prop-2-enimidoyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 142836518 |
| Molecular Formula | C22H27FN4O2 |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 4-amino-N-[3-(dimethylamino)propyl]-3-[(E)-3-(4-fluorophenyl)prop-2-enimidoyl]-2-methoxybenzamide |
| SMILES | [H]/N=C(\C=C\c1ccc(F)cc1)c1c(N)ccc(C(=O)NCCCN(C)C)c1OC |
| InChI | InChI=1S/C22H27FN4O2/c1-27(2)14-4-13-26-22(28)17-10-12-19(25)20(21(17)29-3)18(24)11-7-15-5-8-16(23)9-6-15/h5-12,24H,4,13-14,25H2,1-3H3,(H,26,28)/b11-7+,24-18+ |
| InChIKey | JLQHPRNUTCIUKJ-AAUMYIDQSA-N |
| XLogP | 3.18 |
| TPSA | 91.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|