C25H22FN3O4 — CID 142836339
4-amino-N-(1,3-benzodioxol-5-ylmethyl)-3-[(E)-3-(4-fluorophenyl)prop-2-enimidoyl]-2-methoxybenzamide (PubChem CID 142836339) has the molecular formula C25H22FN3O4 and a molecular weight of 447.47 g/mol. Its IUPAC name is 4-amino-N-(1,3-benzodioxol-5-ylmethyl)-3-[(E)-3-(4-fluorophenyl)prop-2-enimidoyl]-2-methoxybenzamide.
| Compound Name | 4-amino-N-(1,3-benzodioxol-5-ylmethyl)-3-[(E)-3-(4-fluorophenyl)prop-2-enimidoyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 142836339 |
| Molecular Formula | C25H22FN3O4 |
| Molecular Weight | 447.47 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | 4-amino-N-(1,3-benzodioxol-5-ylmethyl)-3-[(E)-3-(4-fluorophenyl)prop-2-enimidoyl]-2-methoxybenzamide |
| SMILES | [H]/N=C(\C=C\c1ccc(F)cc1)c1c(N)ccc(C(=O)NCc2ccc3c(c2)OCO3)c1OC |
| InChI | InChI=1S/C25H22FN3O4/c1-31-24-18(25(30)29-13-16-5-11-21-22(12-16)33-14-32-21)8-10-20(28)23(24)19(27)9-4-15-2-6-17(26)7-3-15/h2-12,27H,13-14,28H2,1H3,(H,29,30)/b9-4+,27-19+ |
| InChIKey | PCPQLQYDAUFTCV-YEGDOLDCSA-N |
| XLogP | 4.16 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.47 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|