C24H23FN4O3 — CID 142836025
4-amino-3-[(E)-3-(4-fluorophenyl)prop-2-enimidoyl]-N-(2-hydroxy-1-pyridin-3-ylethyl)-2-methoxybenzamide (PubChem CID 142836025) has the molecular formula C24H23FN4O3 and a molecular weight of 434.47 g/mol. Its IUPAC name is 4-amino-3-[(E)-3-(4-fluorophenyl)prop-2-enimidoyl]-N-(2-hydroxy-1-pyridin-3-ylethyl)-2-methoxybenzamide.
| Compound Name | 4-amino-3-[(E)-3-(4-fluorophenyl)prop-2-enimidoyl]-N-(2-hydroxy-1-pyridin-3-ylethyl)-2-methoxybenzamide |
|---|---|
| PubChem CID | 142836025 |
| Molecular Formula | C24H23FN4O3 |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 4-amino-3-[(E)-3-(4-fluorophenyl)prop-2-enimidoyl]-N-(2-hydroxy-1-pyridin-3-ylethyl)-2-methoxybenzamide |
| SMILES | [H]/N=C(\C=C\c1ccc(F)cc1)c1c(N)ccc(C(=O)NC(CO)c2cccnc2)c1OC |
| InChI | InChI=1S/C24H23FN4O3/c1-32-23-18(24(31)29-21(14-30)16-3-2-12-28-13-16)9-11-20(27)22(23)19(26)10-6-15-4-7-17(25)8-5-15/h2-13,21,26,30H,14,27H2,1H3,(H,29,31)/b10-6+,26-19+ |
| InChIKey | LMDKCYANDVQUFQ-YTBWGJBBSA-N |
| XLogP | 3.36 |
| TPSA | 121.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|