C22H19F2N3O3 — CID 142836563
4-amino-3-[(E)-3-(3,4-difluorophenyl)prop-2-enimidoyl]-N-(furan-2-ylmethyl)-2-methoxybenzamide (PubChem CID 142836563) has the molecular formula C22H19F2N3O3 and a molecular weight of 411.41 g/mol. Its IUPAC name is 4-amino-3-[(E)-3-(3,4-difluorophenyl)prop-2-enimidoyl]-N-(furan-2-ylmethyl)-2-methoxybenzamide.
| Compound Name | 4-amino-3-[(E)-3-(3,4-difluorophenyl)prop-2-enimidoyl]-N-(furan-2-ylmethyl)-2-methoxybenzamide |
|---|---|
| PubChem CID | 142836563 |
| Molecular Formula | C22H19F2N3O3 |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | 4-amino-3-[(E)-3-(3,4-difluorophenyl)prop-2-enimidoyl]-N-(furan-2-ylmethyl)-2-methoxybenzamide |
| SMILES | [H]/N=C(\C=C\c1ccc(F)c(F)c1)c1c(N)ccc(C(=O)NCc2ccco2)c1OC |
| InChI | InChI=1S/C22H19F2N3O3/c1-29-21-15(22(28)27-12-14-3-2-10-30-14)6-9-19(26)20(21)18(25)8-5-13-4-7-16(23)17(24)11-13/h2-11,25H,12,26H2,1H3,(H,27,28)/b8-5+,25-18+ |
| InChIKey | PCHFHBBOXKKOCO-JWCNJOBLSA-N |
| XLogP | 4.16 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|