C19H18F2N2 — CID 142836389
2-[(E)-3-(3,4-difluorophenyl)prop-2-enimidoyl]-4-ethenyl-3-ethylaniline (PubChem CID 142836389) has the molecular formula C19H18F2N2 and a molecular weight of 312.36 g/mol. Its IUPAC name is 2-[(E)-3-(3,4-difluorophenyl)prop-2-enimidoyl]-4-ethenyl-3-ethylaniline.
| Compound Name | 2-[(E)-3-(3,4-difluorophenyl)prop-2-enimidoyl]-4-ethenyl-3-ethylaniline |
|---|---|
| PubChem CID | 142836389 |
| Molecular Formula | C19H18F2N2 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 2-[(E)-3-(3,4-difluorophenyl)prop-2-enimidoyl]-4-ethenyl-3-ethylaniline |
| SMILES | [H]/N=C(\C=C\c1ccc(F)c(F)c1)c1c(N)ccc(C=C)c1CC |
| InChI | InChI=1S/C19H18F2N2/c1-3-13-7-10-18(23)19(14(13)4-2)17(22)9-6-12-5-8-15(20)16(21)11-12/h3,5-11,22H,1,4,23H2,2H3/b9-6+,22-17+ |
| InChIKey | VPWGTPVGRVFRQN-UULUQNPASA-N |
| XLogP | 4.83 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|