About butane;2-[(E)-3-(2,4-difluorophenyl)prop-2-enimidoyl]-4-ethenyl-3-ethylaniline
butane;2-[(E)-3-(2,4-difluorophenyl)prop-2-enimidoyl]-4-ethenyl-3-ethylaniline (PubChem CID 142836190) has the molecular formula C23H28F2N2
and a molecular weight of 370.49 g/mol. Its IUPAC name is butane;2-[(E)-3-(2,4-difluorophenyl)prop-2-enimidoyl]-4-ethenyl-3-ethylaniline.
Molecular Properties
| Compound Name | butane;2-[(E)-3-(2,4-difluorophenyl)prop-2-enimidoyl]-4-ethenyl-3-ethylaniline |
| PubChem CID | 142836190 |
| Molecular Formula | C23H28F2N2 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | butane;2-[(E)-3-(2,4-difluorophenyl)prop-2-enimidoyl]-4-ethenyl-3-ethylaniline |
| SMILES | CCCC.[H]/N=C(\C=C\c1ccc(F)cc1F)c1c(N)ccc(C=C)c1CC |
| InChI | InChI=1S/C19H18F2N2.C4H10/c1-3-12-6-9-17(22)19(15(12)4-2)18(23)10-7-13-5-8-14(20)11-16(13)21;1-3-4-2/h3,5-11,23H,1,4,22H2,2H3;3-4H2,1-2H3/b10-7+,23-18+; |
| InChIKey | OHNDEPPPFLVVJV-ZHCRRWTCSA-N |
| XLogP | 6.64 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze butane;2-[(E)-3-(2,4-difluorophenyl)prop-2-enimidoyl]-4-ethenyl-3-ethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;2-[(E)-3-(2,4-difluorophenyl)prop-2-enimidoyl]-4-ethenyl-3-ethylaniline?
The IUPAC name of butane;2-[(E)-3-(2,4-difluorophenyl)prop-2-enimidoyl]-4-ethenyl-3-ethylaniline (CID 142836190) is butane;2-[(E)-3-(2,4-difluorophenyl)prop-2-enimidoyl]-4-ethenyl-3-ethylaniline.
What is the SMILES notation for butane;2-[(E)-3-(2,4-difluorophenyl)prop-2-enimidoyl]-4-ethenyl-3-ethylaniline?
The canonical SMILES for butane;2-[(E)-3-(2,4-difluorophenyl)prop-2-enimidoyl]-4-ethenyl-3-ethylaniline is CCCC.[H]/N=C(\C=C\c1ccc(F)cc1F)c1c(N)ccc(C=C)c1CC.
What is the InChIKey of butane;2-[(E)-3-(2,4-difluorophenyl)prop-2-enimidoyl]-4-ethenyl-3-ethylaniline?
The InChIKey is OHNDEPPPFLVVJV-ZHCRRWTCSA-N. The full InChI is InChI=1S/C19H18F2N2.C4H10/c1-3-12-6-9-17(22)19(15(12)4-2)18(23)10-7-13-5-8-14(20)11-16(13)21;1-3-4-2/h3,5-11,23H,1,4,22H2,2H3;3-4H2,1-2H3/b10-7+,23-18+;.
What are the key properties of butane;2-[(E)-3-(2,4-difluorophenyl)prop-2-enimidoyl]-4-ethenyl-3-ethylaniline?
butane;2-[(E)-3-(2,4-difluorophenyl)prop-2-enimidoyl]-4-ethenyl-3-ethylaniline has a molecular weight of 370.49 g/mol, XLogP of 6.64, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butane;2-[(E)-3-(2,4-difluorophenyl)prop-2-enimidoyl]-4-ethenyl-3-ethylaniline is sourced from PubChem (CID 142836190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).