C29H35N3 — CID 142836349
1-cyclopenta-1,3-dien-1-yl-N-methylmethanamine;4-ethenyl-3-ethyl-2-[(E)-3-(3-prop-1-en-2-ylphenyl)prop-2-enimidoyl]aniline (PubChem CID 142836349) has the molecular formula C29H35N3 and a molecular weight of 425.62 g/mol. Its IUPAC name is 1-cyclopenta-1,3-dien-1-yl-N-methylmethanamine;4-ethenyl-3-ethyl-2-[(E)-3-(3-prop-1-en-2-ylphenyl)prop-2-enimidoyl]aniline.
| Compound Name | 1-cyclopenta-1,3-dien-1-yl-N-methylmethanamine;4-ethenyl-3-ethyl-2-[(E)-3-(3-prop-1-en-2-ylphenyl)prop-2-enimidoyl]aniline |
|---|---|
| PubChem CID | 142836349 |
| Molecular Formula | C29H35N3 |
| Molecular Weight | 425.62 g/mol |
| Exact Mass | 425.28 |
| IUPAC Name | 1-cyclopenta-1,3-dien-1-yl-N-methylmethanamine;4-ethenyl-3-ethyl-2-[(E)-3-(3-prop-1-en-2-ylphenyl)prop-2-enimidoyl]aniline |
| SMILES | CNCC1=CC=CC1.[H]/N=C(\C=C\c1cccc(C(=C)C)c1)c1c(N)ccc(C=C)c1CC |
| InChI | InChI=1S/C22H24N2.C7H11N/c1-5-17-11-13-21(24)22(19(17)6-2)20(23)12-10-16-8-7-9-18(14-16)15(3)4;1-8-6-7-4-2-3-5-7/h5,7-14,23H,1,3,6,24H2,2,4H3;2-4,8H,5-6H2,1H3/b12-10+,23-20+; |
| InChIKey | IZUMGGUAFZREKC-KDUOEHFHSA-N |
| XLogP | 6.68 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.62 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|