C17H20 — CID 153358838
1-[(1E,3E,5Z)-3-methylhepta-1,3,5-trienyl]-3-prop-1-en-2-ylbenzene (PubChem CID 153358838) has the molecular formula C17H20 and a molecular weight of 224.35 g/mol. Its IUPAC name is 1-[(1E,3E,5Z)-3-methylhepta-1,3,5-trienyl]-3-prop-1-en-2-ylbenzene.
| Compound Name | 1-[(1E,3E,5Z)-3-methylhepta-1,3,5-trienyl]-3-prop-1-en-2-ylbenzene |
|---|---|
| PubChem CID | 153358838 |
| Molecular Formula | C17H20 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 1-[(1E,3E,5Z)-3-methylhepta-1,3,5-trienyl]-3-prop-1-en-2-ylbenzene |
| SMILES | C=C(C)c1cccc(/C=C/C(C)=C/C=C\C)c1 |
| InChI | InChI=1S/C17H20/c1-5-6-8-15(4)11-12-16-9-7-10-17(13-16)14(2)3/h5-13H,2H2,1,3-4H3/b6-5-,12-11+,15-8+ |
| InChIKey | FVHVXRXMGIWBPZ-HYXCCYDYSA-N |
| XLogP | 5.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|