About 3-prop-1-enylbenzamide
3-prop-1-enylbenzamide (PubChem CID 70146317) has the molecular formula C10H11NO
and a molecular weight of 161.20 g/mol. Its IUPAC name is 3-prop-1-enylbenzamide.
Molecular Properties
| Compound Name | 3-prop-1-enylbenzamide |
| PubChem CID | 70146317 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | 3-prop-1-enylbenzamide |
| SMILES | CC=Cc1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C10H11NO/c1-2-4-8-5-3-6-9(7-8)10(11)12/h2-7H,1H3,(H2,11,12) |
| InChIKey | HMKBKZKUEIPZLX-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-prop-1-enylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-prop-1-enylbenzamide?
The IUPAC name of 3-prop-1-enylbenzamide (CID 70146317) is 3-prop-1-enylbenzamide.
What is the SMILES notation for 3-prop-1-enylbenzamide?
The canonical SMILES for 3-prop-1-enylbenzamide is CC=Cc1cccc(C(N)=O)c1.
What is the InChIKey of 3-prop-1-enylbenzamide?
The InChIKey is HMKBKZKUEIPZLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO/c1-2-4-8-5-3-6-9(7-8)10(11)12/h2-7H,1H3,(H2,11,12).
What are the key properties of 3-prop-1-enylbenzamide?
3-prop-1-enylbenzamide has a molecular weight of 161.20 g/mol, XLogP of 1.82, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-prop-1-enylbenzamide is sourced from PubChem (CID 70146317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).