C25H34 — CID 142077288
(3E)-2,3-dimethylhexa-1,3-diene;1-[(1Z,4Z,6Z)-4-ethenylocta-1,4,6-trienyl]-3-methylbenzene (PubChem CID 142077288) has the molecular formula C25H34 and a molecular weight of 334.55 g/mol. Its IUPAC name is (3E)-2,3-dimethylhexa-1,3-diene;1-[(1Z,4Z,6Z)-4-ethenylocta-1,4,6-trienyl]-3-methylbenzene.
| Compound Name | (3E)-2,3-dimethylhexa-1,3-diene;1-[(1Z,4Z,6Z)-4-ethenylocta-1,4,6-trienyl]-3-methylbenzene |
|---|---|
| PubChem CID | 142077288 |
| Molecular Formula | C25H34 |
| Molecular Weight | 334.55 g/mol |
| Exact Mass | 334.27 |
| IUPAC Name | (3E)-2,3-dimethylhexa-1,3-diene;1-[(1Z,4Z,6Z)-4-ethenylocta-1,4,6-trienyl]-3-methylbenzene |
| SMILES | C=C(C)/C(C)=C/CC.C=C/C(=C\C=C/C)C/C=C\c1cccc(C)c1 |
| InChI | InChI=1S/C17H20.C8H14/c1-4-6-10-16(5-2)11-8-13-17-12-7-9-15(3)14-17;1-5-6-8(4)7(2)3/h4-10,12-14H,2,11H2,1,3H3;6H,2,5H2,1,3-4H3/b6-4-,13-8-,16-10+;8-6+ |
| InChIKey | QLWQNRXRPALRAY-AWUIECJVSA-N |
| XLogP | 8.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.55 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|