C21H31N — CID 156510756
(4E,6Z)-3-[[3-[(Z)-but-1-enyl]phenyl]methyl]-N,4-dimethylocta-4,6-dien-1-amine (PubChem CID 156510756) has the molecular formula C21H31N and a molecular weight of 297.49 g/mol. Its IUPAC name is (4E,6Z)-3-[[3-[(Z)-but-1-enyl]phenyl]methyl]-N,4-dimethylocta-4,6-dien-1-amine.
| Compound Name | (4E,6Z)-3-[[3-[(Z)-but-1-enyl]phenyl]methyl]-N,4-dimethylocta-4,6-dien-1-amine |
|---|---|
| PubChem CID | 156510756 |
| Molecular Formula | C21H31N |
| Molecular Weight | 297.49 g/mol |
| Exact Mass | 297.25 |
| IUPAC Name | (4E,6Z)-3-[[3-[(Z)-but-1-enyl]phenyl]methyl]-N,4-dimethylocta-4,6-dien-1-amine |
| SMILES | C/C=C\C=C(/C)C(CCNC)Cc1cccc(/C=C\CC)c1 |
| InChI | InChI=1S/C21H31N/c1-5-7-10-18(3)21(14-15-22-4)17-20-13-9-12-19(16-20)11-8-6-2/h5,7-13,16,21-22H,6,14-15,17H2,1-4H3/b7-5-,11-8-,18-10+ |
| InChIKey | ZIHYUFPCNHMTDX-TULRPWLGSA-N |
| XLogP | 5.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.49 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|