C19H20N2O5 — CID 142836212
4-amino-3-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enimidoyl]-2-methoxybenzoic acid (PubChem CID 142836212) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is 4-amino-3-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enimidoyl]-2-methoxybenzoic acid.
| Compound Name | 4-amino-3-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enimidoyl]-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 142836212 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 4-amino-3-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enimidoyl]-2-methoxybenzoic acid |
| SMILES | [H]/N=C(\C=C\c1ccc(OC)c(OC)c1)c1c(N)ccc(C(=O)O)c1OC |
| InChI | InChI=1S/C19H20N2O5/c1-24-15-9-5-11(10-16(15)25-2)4-7-13(20)17-14(21)8-6-12(19(22)23)18(17)26-3/h4-10,20H,21H2,1-3H3,(H,22,23)/b7-4+,20-13+ |
| InChIKey | LWIFQVDFEOIORJ-UJPRRALESA-N |
| XLogP | 3.07 |
| TPSA | 114.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|