C22H23N3O3 — CID 142835677
4-amino-3-[(E)-3-(2,3-dihydro-1-benzofuran-5-yl)prop-2-enimidoyl]-2-methoxy-N-prop-2-enylbenzamide (PubChem CID 142835677) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is 4-amino-3-[(E)-3-(2,3-dihydro-1-benzofuran-5-yl)prop-2-enimidoyl]-2-methoxy-N-prop-2-enylbenzamide.
| Compound Name | 4-amino-3-[(E)-3-(2,3-dihydro-1-benzofuran-5-yl)prop-2-enimidoyl]-2-methoxy-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 142835677 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 4-amino-3-[(E)-3-(2,3-dihydro-1-benzofuran-5-yl)prop-2-enimidoyl]-2-methoxy-N-prop-2-enylbenzamide |
| SMILES | [H]/N=C(\C=C\c1ccc2c(c1)CCO2)c1c(N)ccc(C(=O)NCC=C)c1OC |
| InChI | InChI=1S/C22H23N3O3/c1-3-11-25-22(26)16-6-8-18(24)20(21(16)27-2)17(23)7-4-14-5-9-19-15(13-14)10-12-28-19/h3-9,13,23H,1,10-12,24H2,2H3,(H,25,26)/b7-4+,23-17+ |
| InChIKey | USRYQDGTELRTKG-KHGFYGEVSA-N |
| XLogP | 3.21 |
| TPSA | 97.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|