C21H16FN3O2S — CID 154534109
4-amino-3-(1-benzothiophene-2-carboximidoyl)-2-fluoro-N-(furan-2-ylmethyl)benzamide (PubChem CID 154534109) has the molecular formula C21H16FN3O2S and a molecular weight of 393.44 g/mol. Its IUPAC name is 4-amino-3-(1-benzothiophene-2-carboximidoyl)-2-fluoro-N-(furan-2-ylmethyl)benzamide.
| Compound Name | 4-amino-3-(1-benzothiophene-2-carboximidoyl)-2-fluoro-N-(furan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 154534109 |
| Molecular Formula | C21H16FN3O2S |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 4-amino-3-(1-benzothiophene-2-carboximidoyl)-2-fluoro-N-(furan-2-ylmethyl)benzamide |
| SMILES | [H]/N=C(\c1cc2ccccc2s1)c1c(N)ccc(C(=O)NCc2ccco2)c1F |
| InChI | InChI=1S/C21H16FN3O2S/c22-19-14(21(26)25-11-13-5-3-9-27-13)7-8-15(23)18(19)20(24)17-10-12-4-1-2-6-16(12)28-17/h1-10,24H,11,23H2,(H,25,26)/b24-20+ |
| InChIKey | OBWDPSCZNCZDKM-HIXSDJFHSA-N |
| XLogP | 4.56 |
| TPSA | 92.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|