C15H12N2O4 — CID 19574143
N-(furan-2-ylmethyl)-8-hydroxy-2-iminochromene-3-carboxamide (PubChem CID 19574143) has the molecular formula C15H12N2O4 and a molecular weight of 284.27 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-8-hydroxy-2-iminochromene-3-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-8-hydroxy-2-iminochromene-3-carboxamide |
|---|---|
| PubChem CID | 19574143 |
| Molecular Formula | C15H12N2O4 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | N-(furan-2-ylmethyl)-8-hydroxy-2-iminochromene-3-carboxamide |
| SMILES | [H]/N=c1\oc2c(O)cccc2cc1C(=O)NCc1ccco1 |
| InChI | InChI=1S/C15H12N2O4/c16-14-11(15(19)17-8-10-4-2-6-20-10)7-9-3-1-5-12(18)13(9)21-14/h1-7,16,18H,8H2,(H,17,19)/b16-14- |
| InChIKey | VOOMEEBRIIYEAT-PEZBUJJGSA-N |
| XLogP | 2.14 |
| TPSA | 99.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |