C23H19FN2O4 — CID 51368279
2-(4-fluoro-2-methylphenyl)imino-N-(furan-2-ylmethyl)-8-methoxychromene-3-carboxamide (PubChem CID 51368279) has the molecular formula C23H19FN2O4 and a molecular weight of 406.41 g/mol. Its IUPAC name is 2-(4-fluoro-2-methylphenyl)imino-N-(furan-2-ylmethyl)-8-methoxychromene-3-carboxamide.
| Compound Name | 2-(4-fluoro-2-methylphenyl)imino-N-(furan-2-ylmethyl)-8-methoxychromene-3-carboxamide |
|---|---|
| PubChem CID | 51368279 |
| Molecular Formula | C23H19FN2O4 |
| Molecular Weight | 406.41 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 2-(4-fluoro-2-methylphenyl)imino-N-(furan-2-ylmethyl)-8-methoxychromene-3-carboxamide |
| SMILES | COc1cccc2cc(C(=O)NCc3ccco3)/c(=N/c3ccc(F)cc3C)oc12 |
| InChI | InChI=1S/C23H19FN2O4/c1-14-11-16(24)8-9-19(14)26-23-18(22(27)25-13-17-6-4-10-29-17)12-15-5-3-7-20(28-2)21(15)30-23/h3-12H,13H2,1-2H3,(H,25,27)/b26-23- |
| InChIKey | FCNHZAMUYVTIPY-RWEWTDSWSA-N |
| XLogP | 4.64 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.41 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |