C22H21FN2O4 — CID 1135040
2-(4-fluorophenyl)imino-8-methoxy-N-[[(2S)-oxolan-2-yl]methyl]chromene-3-carboxamide (PubChem CID 1135040) has the molecular formula C22H21FN2O4 and a molecular weight of 396.42 g/mol. Its IUPAC name is 2-(4-fluorophenyl)imino-8-methoxy-N-[[(2S)-oxolan-2-yl]methyl]chromene-3-carboxamide.
| Compound Name | 2-(4-fluorophenyl)imino-8-methoxy-N-[[(2S)-oxolan-2-yl]methyl]chromene-3-carboxamide |
|---|---|
| PubChem CID | 1135040 |
| Molecular Formula | C22H21FN2O4 |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 2-(4-fluorophenyl)imino-8-methoxy-N-[[(2S)-oxolan-2-yl]methyl]chromene-3-carboxamide |
| SMILES | COc1cccc2cc(C(=O)NC[C@@H]3CCCO3)/c(=N/c3ccc(F)cc3)oc12 |
| InChI | InChI=1S/C22H21FN2O4/c1-27-19-6-2-4-14-12-18(21(26)24-13-17-5-3-11-28-17)22(29-20(14)19)25-16-9-7-15(23)8-10-16/h2,4,6-10,12,17H,3,5,11,13H2,1H3,(H,24,26)/b25-22-/t17-/m0/s1 |
| InChIKey | FZGGCNWAIYQOBU-QEQSUZCXSA-N |
| XLogP | 3.72 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |