C25H26N2O6 — CID 95185034
ethyl 4-[[8-methoxy-3-[[(2S)-oxolan-2-yl]methylcarbamoyl]chromen-2-ylidene]amino]benzoate (PubChem CID 95185034) has the molecular formula C25H26N2O6 and a molecular weight of 450.49 g/mol. Its IUPAC name is ethyl 4-[[8-methoxy-3-[[(2S)-oxolan-2-yl]methylcarbamoyl]chromen-2-ylidene]amino]benzoate.
| Compound Name | ethyl 4-[[8-methoxy-3-[[(2S)-oxolan-2-yl]methylcarbamoyl]chromen-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 95185034 |
| Molecular Formula | C25H26N2O6 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | ethyl 4-[[8-methoxy-3-[[(2S)-oxolan-2-yl]methylcarbamoyl]chromen-2-ylidene]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(/N=c2\oc3c(OC)cccc3cc2C(=O)NC[C@@H]2CCCO2)cc1 |
| InChI | InChI=1S/C25H26N2O6/c1-3-31-25(29)16-9-11-18(12-10-16)27-24-20(23(28)26-15-19-7-5-13-32-19)14-17-6-4-8-21(30-2)22(17)33-24/h4,6,8-12,14,19H,3,5,7,13,15H2,1-2H3,(H,26,28)/b27-24-/t19-/m0/s1 |
| InChIKey | NDUXOBLIPQUMOR-ADKFBQBXSA-N |
| XLogP | 3.76 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |