C22H22N2O4 — CID 1134964
2-(3-methoxyphenyl)imino-N-[[(2S)-oxolan-2-yl]methyl]chromene-3-carboxamide (PubChem CID 1134964) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)imino-N-[[(2S)-oxolan-2-yl]methyl]chromene-3-carboxamide.
| Compound Name | 2-(3-methoxyphenyl)imino-N-[[(2S)-oxolan-2-yl]methyl]chromene-3-carboxamide |
|---|---|
| PubChem CID | 1134964 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 2-(3-methoxyphenyl)imino-N-[[(2S)-oxolan-2-yl]methyl]chromene-3-carboxamide |
| SMILES | COc1cccc(/N=c2\oc3ccccc3cc2C(=O)NC[C@@H]2CCCO2)c1 |
| InChI | InChI=1S/C22H22N2O4/c1-26-17-8-4-7-16(13-17)24-22-19(12-15-6-2-3-10-20(15)28-22)21(25)23-14-18-9-5-11-27-18/h2-4,6-8,10,12-13,18H,5,9,11,14H2,1H3,(H,23,25)/b24-22-/t18-/m0/s1 |
| InChIKey | MXJAWLGSASZGND-LWVPEANGSA-N |
| XLogP | 3.58 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |