C21H19FN2O4 — CID 135631749
2-(3-fluorophenyl)imino-7-hydroxy-N-(oxolan-2-ylmethyl)chromene-3-carboxamide (PubChem CID 135631749) has the molecular formula C21H19FN2O4 and a molecular weight of 382.39 g/mol. Its IUPAC name is 2-(3-fluorophenyl)imino-7-hydroxy-N-(oxolan-2-ylmethyl)chromene-3-carboxamide.
| Compound Name | 2-(3-fluorophenyl)imino-7-hydroxy-N-(oxolan-2-ylmethyl)chromene-3-carboxamide |
|---|---|
| PubChem CID | 135631749 |
| Molecular Formula | C21H19FN2O4 |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 2-(3-fluorophenyl)imino-7-hydroxy-N-(oxolan-2-ylmethyl)chromene-3-carboxamide |
| SMILES | O=C(NCC1CCCO1)c1cc2ccc(O)cc2o/c1=N\c1cccc(F)c1 |
| InChI | InChI=1S/C21H19FN2O4/c22-14-3-1-4-15(10-14)24-21-18(20(26)23-12-17-5-2-8-27-17)9-13-6-7-16(25)11-19(13)28-21/h1,3-4,6-7,9-11,17,25H,2,5,8,12H2,(H,23,26)/b24-21- |
| InChIKey | VLNXQXJFUIZFMJ-FLFQWRMESA-N |
| XLogP | 3.42 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |