C21H20N2O4 — CID 135631732
7-hydroxy-N-(oxolan-2-ylmethyl)-2-phenyliminochromene-3-carboxamide (PubChem CID 135631732) has the molecular formula C21H20N2O4 and a molecular weight of 364.40 g/mol. Its IUPAC name is 7-hydroxy-N-(oxolan-2-ylmethyl)-2-phenyliminochromene-3-carboxamide.
| Compound Name | 7-hydroxy-N-(oxolan-2-ylmethyl)-2-phenyliminochromene-3-carboxamide |
|---|---|
| PubChem CID | 135631732 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 7-hydroxy-N-(oxolan-2-ylmethyl)-2-phenyliminochromene-3-carboxamide |
| SMILES | O=C(NCC1CCCO1)c1cc2ccc(O)cc2o/c1=N\c1ccccc1 |
| InChI | InChI=1S/C21H20N2O4/c24-16-9-8-14-11-18(20(25)22-13-17-7-4-10-26-17)21(27-19(14)12-16)23-15-5-2-1-3-6-15/h1-3,5-6,8-9,11-12,17,24H,4,7,10,13H2,(H,22,25)/b23-21- |
| InChIKey | UNHNFEVREZZZQO-LNVKXUELSA-N |
| XLogP | 3.28 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |