C24H23BrN2O5 — CID 51366912
ethyl 4-[[6-bromo-3-(oxolan-2-ylmethylcarbamoyl)chromen-2-ylidene]amino]benzoate (PubChem CID 51366912) has the molecular formula C24H23BrN2O5 and a molecular weight of 499.36 g/mol. Its IUPAC name is ethyl 4-[[6-bromo-3-(oxolan-2-ylmethylcarbamoyl)chromen-2-ylidene]amino]benzoate.
| Compound Name | ethyl 4-[[6-bromo-3-(oxolan-2-ylmethylcarbamoyl)chromen-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 51366912 |
| Molecular Formula | C24H23BrN2O5 |
| Molecular Weight | 499.36 g/mol |
| Exact Mass | 498.08 |
| IUPAC Name | ethyl 4-[[6-bromo-3-(oxolan-2-ylmethylcarbamoyl)chromen-2-ylidene]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(/N=c2\oc3ccc(Br)cc3cc2C(=O)NCC2CCCO2)cc1 |
| InChI | InChI=1S/C24H23BrN2O5/c1-2-30-24(29)15-5-8-18(9-6-15)27-23-20(22(28)26-14-19-4-3-11-31-19)13-16-12-17(25)7-10-21(16)32-23/h5-10,12-13,19H,2-4,11,14H2,1H3,(H,26,28)/b27-23- |
| InChIKey | WWXAIFNPCLEDKR-VYIQYICTSA-N |
| XLogP | 4.51 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.36 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |