C23H23BrN2O4 — CID 95184777
6-bromo-2-(2-ethoxyphenyl)imino-N-[[(2R)-oxolan-2-yl]methyl]chromene-3-carboxamide (PubChem CID 95184777) has the molecular formula C23H23BrN2O4 and a molecular weight of 471.35 g/mol. Its IUPAC name is 6-bromo-2-(2-ethoxyphenyl)imino-N-[[(2R)-oxolan-2-yl]methyl]chromene-3-carboxamide.
| Compound Name | 6-bromo-2-(2-ethoxyphenyl)imino-N-[[(2R)-oxolan-2-yl]methyl]chromene-3-carboxamide |
|---|---|
| PubChem CID | 95184777 |
| Molecular Formula | C23H23BrN2O4 |
| Molecular Weight | 471.35 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | 6-bromo-2-(2-ethoxyphenyl)imino-N-[[(2R)-oxolan-2-yl]methyl]chromene-3-carboxamide |
| SMILES | CCOc1ccccc1/N=c1\oc2ccc(Br)cc2cc1C(=O)NC[C@H]1CCCO1 |
| InChI | InChI=1S/C23H23BrN2O4/c1-2-28-21-8-4-3-7-19(21)26-23-18(22(27)25-14-17-6-5-11-29-17)13-15-12-16(24)9-10-20(15)30-23/h3-4,7-10,12-13,17H,2,5-6,11,14H2,1H3,(H,25,27)/b26-23-/t17-/m1/s1 |
| InChIKey | LUAFKJNVTUEQBA-PIHGLKBESA-N |
| XLogP | 4.74 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.35 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |