C22H20BrFN2O3 — CID 51366947
6-bromo-2-(3-fluoro-2-methylphenyl)imino-N-(oxolan-2-ylmethyl)chromene-3-carboxamide (PubChem CID 51366947) has the molecular formula C22H20BrFN2O3 and a molecular weight of 459.32 g/mol. Its IUPAC name is 6-bromo-2-(3-fluoro-2-methylphenyl)imino-N-(oxolan-2-ylmethyl)chromene-3-carboxamide.
| Compound Name | 6-bromo-2-(3-fluoro-2-methylphenyl)imino-N-(oxolan-2-ylmethyl)chromene-3-carboxamide |
|---|---|
| PubChem CID | 51366947 |
| Molecular Formula | C22H20BrFN2O3 |
| Molecular Weight | 459.32 g/mol |
| Exact Mass | 458.06 |
| IUPAC Name | 6-bromo-2-(3-fluoro-2-methylphenyl)imino-N-(oxolan-2-ylmethyl)chromene-3-carboxamide |
| SMILES | Cc1c(F)cccc1/N=c1\oc2ccc(Br)cc2cc1C(=O)NCC1CCCO1 |
| InChI | InChI=1S/C22H20BrFN2O3/c1-13-18(24)5-2-6-19(13)26-22-17(21(27)25-12-16-4-3-9-28-16)11-14-10-15(23)7-8-20(14)29-22/h2,5-8,10-11,16H,3-4,9,12H2,1H3,(H,25,27)/b26-22- |
| InChIKey | DNAXZFMXNSNRIA-ROMGYVFFSA-N |
| XLogP | 4.78 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.32 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |