C22H20N2O4S2 — CID 50810462
5-[benzyl(methylsulfonyl)amino]-N-(furan-2-ylmethyl)-1-benzothiophene-2-carboxamide (PubChem CID 50810462) has the molecular formula C22H20N2O4S2 and a molecular weight of 440.55 g/mol. Its IUPAC name is 5-[benzyl(methylsulfonyl)amino]-N-(furan-2-ylmethyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 5-[benzyl(methylsulfonyl)amino]-N-(furan-2-ylmethyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 50810462 |
| Molecular Formula | C22H20N2O4S2 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | 5-[benzyl(methylsulfonyl)amino]-N-(furan-2-ylmethyl)-1-benzothiophene-2-carboxamide |
| SMILES | CS(=O)(=O)N(Cc1ccccc1)c1ccc2sc(C(=O)NCc3ccco3)cc2c1 |
| InChI | InChI=1S/C22H20N2O4S2/c1-30(26,27)24(15-16-6-3-2-4-7-16)18-9-10-20-17(12-18)13-21(29-20)22(25)23-14-19-8-5-11-28-19/h2-13H,14-15H2,1H3,(H,23,25) |
| InChIKey | YOXDLEWFBOAVCI-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |