C20H18Cl2N2O4S — CID 53287315
4-[(3,5-dichloro-N-methylsulfonylanilino)methyl]-N-(furan-2-ylmethyl)benzamide (PubChem CID 53287315) has the molecular formula C20H18Cl2N2O4S and a molecular weight of 453.35 g/mol. Its IUPAC name is 4-[(3,5-dichloro-N-methylsulfonylanilino)methyl]-N-(furan-2-ylmethyl)benzamide.
| Compound Name | 4-[(3,5-dichloro-N-methylsulfonylanilino)methyl]-N-(furan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 53287315 |
| Molecular Formula | C20H18Cl2N2O4S |
| Molecular Weight | 453.35 g/mol |
| Exact Mass | 452.04 |
| IUPAC Name | 4-[(3,5-dichloro-N-methylsulfonylanilino)methyl]-N-(furan-2-ylmethyl)benzamide |
| SMILES | CS(=O)(=O)N(Cc1ccc(C(=O)NCc2ccco2)cc1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C20H18Cl2N2O4S/c1-29(26,27)24(18-10-16(21)9-17(22)11-18)13-14-4-6-15(7-5-14)20(25)23-12-19-3-2-8-28-19/h2-11H,12-13H2,1H3,(H,23,25) |
| InChIKey | RJVMKQNNTUTZJK-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.35 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |