C20H21FN3O2+ — CID 142836499
[(E)-1-[6-amino-2-methoxy-3-(prop-2-enylcarbamoyl)phenyl]-3-(4-fluorophenyl)prop-2-enylidene]azanium (PubChem CID 142836499) has the molecular formula C20H21FN3O2+ and a molecular weight of 354.41 g/mol. Its IUPAC name is [(E)-1-[6-amino-2-methoxy-3-(prop-2-enylcarbamoyl)phenyl]-3-(4-fluorophenyl)prop-2-enylidene]azanium.
| Compound Name | [(E)-1-[6-amino-2-methoxy-3-(prop-2-enylcarbamoyl)phenyl]-3-(4-fluorophenyl)prop-2-enylidene]azanium |
|---|---|
| PubChem CID | 142836499 |
| Molecular Formula | C20H21FN3O2+ |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | [(E)-1-[6-amino-2-methoxy-3-(prop-2-enylcarbamoyl)phenyl]-3-(4-fluorophenyl)prop-2-enylidene]azanium |
| SMILES | C=CCNC(=O)c1ccc(N)c(C(=[NH2+])/C=C/c2ccc(F)cc2)c1OC |
| InChI | InChI=1S/C20H20FN3O2/c1-3-12-24-20(25)15-9-11-17(23)18(19(15)26-2)16(22)10-6-13-4-7-14(21)8-5-13/h3-11,22H,1,12,23H2,2H3,(H,24,25)/p+1/b10-6+,22-16? |
| InChIKey | QGQWINMEHICENI-OCUVUBMOSA-O |
| XLogP | 1.59 |
| TPSA | 89.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|