C23H20FN3O — CID 142836347
N-[4-amino-2-fluoro-5-[(E)-3-naphthalen-2-ylprop-2-enimidoyl]phenyl]cyclopropanecarboxamide (PubChem CID 142836347) has the molecular formula C23H20FN3O and a molecular weight of 373.43 g/mol. Its IUPAC name is N-[4-amino-2-fluoro-5-[(E)-3-naphthalen-2-ylprop-2-enimidoyl]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[4-amino-2-fluoro-5-[(E)-3-naphthalen-2-ylprop-2-enimidoyl]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 142836347 |
| Molecular Formula | C23H20FN3O |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | N-[4-amino-2-fluoro-5-[(E)-3-naphthalen-2-ylprop-2-enimidoyl]phenyl]cyclopropanecarboxamide |
| SMILES | [H]/N=C(/C=C/c1ccc2ccccc2c1)c1cc(NC(=O)C2CC2)c(F)cc1N |
| InChI | InChI=1S/C23H20FN3O/c24-19-13-21(26)18(12-22(19)27-23(28)16-8-9-16)20(25)10-6-14-5-7-15-3-1-2-4-17(15)11-14/h1-7,10-13,16,25H,8-9,26H2,(H,27,28)/b10-6+,25-20- |
| InChIKey | XTNGALFCTOXWNW-HWEUDGKPSA-N |
| XLogP | 4.99 |
| TPSA | 78.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|