C24H29F2N3 — CID 142835831
N-(cyclopentylmethyl)ethenamine;5-fluoro-2-[(E)-3-(3-fluorophenyl)prop-2-enimidoyl]-4-methylaniline (PubChem CID 142835831) has the molecular formula C24H29F2N3 and a molecular weight of 397.51 g/mol. Its IUPAC name is N-(cyclopentylmethyl)ethenamine;5-fluoro-2-[(E)-3-(3-fluorophenyl)prop-2-enimidoyl]-4-methylaniline.
| Compound Name | N-(cyclopentylmethyl)ethenamine;5-fluoro-2-[(E)-3-(3-fluorophenyl)prop-2-enimidoyl]-4-methylaniline |
|---|---|
| PubChem CID | 142835831 |
| Molecular Formula | C24H29F2N3 |
| Molecular Weight | 397.51 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | N-(cyclopentylmethyl)ethenamine;5-fluoro-2-[(E)-3-(3-fluorophenyl)prop-2-enimidoyl]-4-methylaniline |
| SMILES | C=CNCC1CCCC1.[H]/N=C(\C=C\c1cccc(F)c1)c1cc(C)c(F)cc1N |
| InChI | InChI=1S/C16H14F2N2.C8H15N/c1-10-7-13(16(20)9-14(10)18)15(19)6-5-11-3-2-4-12(17)8-11;1-2-9-7-8-5-3-4-6-8/h2-9,19H,20H2,1H3;2,8-9H,1,3-7H2/b6-5+,19-15+; |
| InChIKey | POPUPLQCGGCPEC-LOXBMXJXSA-N |
| XLogP | 5.85 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.51 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|