C33H39N3OS — CID 143463953
N-[4-amino-2-methyl-5-[(E)-3-[3-[2-(3-prop-1-en-2-ylcyclohexyl)ethyl]phenyl]prop-2-enimidoyl]phenyl]-2-thiophen-2-ylacetamide (PubChem CID 143463953) has the molecular formula C33H39N3OS and a molecular weight of 525.76 g/mol. Its IUPAC name is N-[4-amino-2-methyl-5-[(E)-3-[3-[2-(3-prop-1-en-2-ylcyclohexyl)ethyl]phenyl]prop-2-enimidoyl]phenyl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[4-amino-2-methyl-5-[(E)-3-[3-[2-(3-prop-1-en-2-ylcyclohexyl)ethyl]phenyl]prop-2-enimidoyl]phenyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 143463953 |
| Molecular Formula | C33H39N3OS |
| Molecular Weight | 525.76 g/mol |
| Exact Mass | 525.28 |
| IUPAC Name | N-[4-amino-2-methyl-5-[(E)-3-[3-[2-(3-prop-1-en-2-ylcyclohexyl)ethyl]phenyl]prop-2-enimidoyl]phenyl]-2-thiophen-2-ylacetamide |
| SMILES | [H]/N=C(\C=C\c1cccc(CCC2CCCC(C(=C)C)C2)c1)c1cc(NC(=O)Cc2cccs2)c(C)cc1N |
| InChI | InChI=1S/C33H39N3OS/c1-22(2)27-10-5-9-26(19-27)13-12-24-7-4-8-25(18-24)14-15-30(34)29-21-32(23(3)17-31(29)35)36-33(37)20-28-11-6-16-38-28/h4,6-8,11,14-18,21,26-27,34H,1,5,9-10,12-13,19-20,35H2,2-3H3,(H,36,37)/b15-14+,34-30+ |
| InChIKey | RVAWMMYRECEJIX-OTZBKOGYSA-N |
| XLogP | 8.22 |
| TPSA | 78.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.76 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|