C20H18N4O3S — CID 89362712
N-[4-amino-2-methyl-5-(3-nitrobenzenecarboximidoyl)phenyl]-2-thiophen-2-ylacetamide (PubChem CID 89362712) has the molecular formula C20H18N4O3S and a molecular weight of 394.46 g/mol. Its IUPAC name is N-[4-amino-2-methyl-5-(3-nitrobenzenecarboximidoyl)phenyl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[4-amino-2-methyl-5-(3-nitrobenzenecarboximidoyl)phenyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 89362712 |
| Molecular Formula | C20H18N4O3S |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | N-[4-amino-2-methyl-5-(3-nitrobenzenecarboximidoyl)phenyl]-2-thiophen-2-ylacetamide |
| SMILES | [H]/N=C(\c1cccc([N+](=O)[O-])c1)c1cc(NC(=O)Cc2cccs2)c(C)cc1N |
| InChI | InChI=1S/C20H18N4O3S/c1-12-8-17(21)16(20(22)13-4-2-5-14(9-13)24(26)27)11-18(12)23-19(25)10-15-6-3-7-28-15/h2-9,11,22H,10,21H2,1H3,(H,23,25)/b22-20+ |
| InChIKey | JRTXVLNVBIXQOC-LSDHQDQOSA-N |
| XLogP | 4.14 |
| TPSA | 122.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|