C18H19FN4OS — CID 142835765
N-[5-amino-6-(3-fluorobenzenecarboximidoyl)-2-pyridinyl]-2-thiophen-2-ylacetamide;molecular hydrogen (PubChem CID 142835765) has the molecular formula C18H19FN4OS and a molecular weight of 358.44 g/mol. Its IUPAC name is N-[5-amino-6-(3-fluorobenzenecarboximidoyl)-2-pyridinyl]-2-thiophen-2-ylacetamide;molecular hydrogen.
| Compound Name | N-[5-amino-6-(3-fluorobenzenecarboximidoyl)-2-pyridinyl]-2-thiophen-2-ylacetamide;molecular hydrogen |
|---|---|
| PubChem CID | 142835765 |
| Molecular Formula | C18H19FN4OS |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | N-[5-amino-6-(3-fluorobenzenecarboximidoyl)-2-pyridinyl]-2-thiophen-2-ylacetamide;molecular hydrogen |
| SMILES | [H]/N=C(\c1cccc(F)c1)c1nc(NC(=O)Cc2cccs2)ccc1N.[H][H].[H][H] |
| InChI | InChI=1S/C18H15FN4OS.2H2/c19-12-4-1-3-11(9-12)17(21)18-14(20)6-7-15(23-18)22-16(24)10-13-5-2-8-25-13;;/h1-9,21H,10,20H2,(H,22,23,24);2*1H/b21-17+;; |
| InChIKey | GLJJFJLIOWYOMX-PJPLBZAPSA-N |
| XLogP | 3.95 |
| TPSA | 91.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|