C21H16FN3OS2 — CID 142179012
N-[4-amino-5-(1-benzothiophene-2-carboximidoyl)-2-fluorophenyl]-2-thiophen-2-ylacetamide (PubChem CID 142179012) has the molecular formula C21H16FN3OS2 and a molecular weight of 409.51 g/mol. Its IUPAC name is N-[4-amino-5-(1-benzothiophene-2-carboximidoyl)-2-fluorophenyl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[4-amino-5-(1-benzothiophene-2-carboximidoyl)-2-fluorophenyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 142179012 |
| Molecular Formula | C21H16FN3OS2 |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | N-[4-amino-5-(1-benzothiophene-2-carboximidoyl)-2-fluorophenyl]-2-thiophen-2-ylacetamide |
| SMILES | [H]/N=C(\c1cc2ccccc2s1)c1cc(NC(=O)Cc2cccs2)c(F)cc1N |
| InChI | InChI=1S/C21H16FN3OS2/c22-15-11-16(23)14(10-17(15)25-20(26)9-13-5-3-7-27-13)21(24)19-8-12-4-1-2-6-18(12)28-19/h1-8,10-11,24H,9,23H2,(H,25,26)/b24-21- |
| InChIKey | NQGKJAAQLFEKIB-FLFQWRMESA-N |
| XLogP | 5.28 |
| TPSA | 78.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|