C19H14N2OS2 — CID 9117027
N-[2-(1,3-benzothiazol-2-yl)phenyl]-2-thiophen-2-ylacetamide (PubChem CID 9117027) has the molecular formula C19H14N2OS2 and a molecular weight of 350.47 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-yl)phenyl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[2-(1,3-benzothiazol-2-yl)phenyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 9117027 |
| Molecular Formula | C19H14N2OS2 |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-yl)phenyl]-2-thiophen-2-ylacetamide |
| SMILES | O=C(Cc1cccs1)Nc1ccccc1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C19H14N2OS2/c22-18(12-13-6-5-11-23-13)20-15-8-2-1-7-14(15)19-21-16-9-3-4-10-17(16)24-19/h1-11H,12H2,(H,20,22) |
| InChIKey | PPNGBQHJBDOSSO-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |