C24H18N4O2S3 — CID 38749982
N-[4-[2-[3-(1,3-benzothiazol-2-yl)anilino]-2-oxoethyl]-1,3-thiazol-2-yl]-2-thiophen-2-ylacetamide (PubChem CID 38749982) has the molecular formula C24H18N4O2S3 and a molecular weight of 490.64 g/mol. Its IUPAC name is N-[4-[2-[3-(1,3-benzothiazol-2-yl)anilino]-2-oxoethyl]-1,3-thiazol-2-yl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[4-[2-[3-(1,3-benzothiazol-2-yl)anilino]-2-oxoethyl]-1,3-thiazol-2-yl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 38749982 |
| Molecular Formula | C24H18N4O2S3 |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.06 |
| IUPAC Name | N-[4-[2-[3-(1,3-benzothiazol-2-yl)anilino]-2-oxoethyl]-1,3-thiazol-2-yl]-2-thiophen-2-ylacetamide |
| SMILES | O=C(Cc1csc(NC(=O)Cc2cccs2)n1)Nc1cccc(-c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C24H18N4O2S3/c29-21(12-17-14-32-24(26-17)28-22(30)13-18-7-4-10-31-18)25-16-6-3-5-15(11-16)23-27-19-8-1-2-9-20(19)33-23/h1-11,14H,12-13H2,(H,25,29)(H,26,28,30) |
| InChIKey | MJADYTXJPUMNRJ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_E(2)', 'substructure': 'N/A'} |
|---|