C20H19N3O2S2 — CID 39905915
N-[4-[2-(2,3-dihydro-1H-inden-5-ylamino)-2-oxoethyl]-1,3-thiazol-2-yl]-2-thiophen-2-ylacetamide (PubChem CID 39905915) has the molecular formula C20H19N3O2S2 and a molecular weight of 397.53 g/mol. Its IUPAC name is N-[4-[2-(2,3-dihydro-1H-inden-5-ylamino)-2-oxoethyl]-1,3-thiazol-2-yl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[4-[2-(2,3-dihydro-1H-inden-5-ylamino)-2-oxoethyl]-1,3-thiazol-2-yl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 39905915 |
| Molecular Formula | C20H19N3O2S2 |
| Molecular Weight | 397.53 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | N-[4-[2-(2,3-dihydro-1H-inden-5-ylamino)-2-oxoethyl]-1,3-thiazol-2-yl]-2-thiophen-2-ylacetamide |
| SMILES | O=C(Cc1csc(NC(=O)Cc2cccs2)n1)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C20H19N3O2S2/c24-18(21-15-7-6-13-3-1-4-14(13)9-15)10-16-12-27-20(22-16)23-19(25)11-17-5-2-8-26-17/h2,5-9,12H,1,3-4,10-11H2,(H,21,24)(H,22,23,25) |
| InChIKey | SVGJIDNJGNECBE-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.53 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_E(2)', 'substructure': 'N/A'} |
|---|