C19H26N4O2S2 — CID 55912219
N-[4-[2-[[1-(dimethylamino)cyclopentyl]methylamino]-2-oxoethyl]-1,3-thiazol-2-yl]-2-thiophen-2-ylacetamide (PubChem CID 55912219) has the molecular formula C19H26N4O2S2 and a molecular weight of 406.58 g/mol. Its IUPAC name is N-[4-[2-[[1-(dimethylamino)cyclopentyl]methylamino]-2-oxoethyl]-1,3-thiazol-2-yl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[4-[2-[[1-(dimethylamino)cyclopentyl]methylamino]-2-oxoethyl]-1,3-thiazol-2-yl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 55912219 |
| Molecular Formula | C19H26N4O2S2 |
| Molecular Weight | 406.58 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | N-[4-[2-[[1-(dimethylamino)cyclopentyl]methylamino]-2-oxoethyl]-1,3-thiazol-2-yl]-2-thiophen-2-ylacetamide |
| SMILES | CN(C)C1(CNC(=O)Cc2csc(NC(=O)Cc3cccs3)n2)CCCC1 |
| InChI | InChI=1S/C19H26N4O2S2/c1-23(2)19(7-3-4-8-19)13-20-16(24)10-14-12-27-18(21-14)22-17(25)11-15-6-5-9-26-15/h5-6,9,12H,3-4,7-8,10-11,13H2,1-2H3,(H,20,24)(H,21,22,25) |
| InChIKey | YRFWQEMSHOMLPJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.58 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_E(2)', 'substructure': 'N/A'} |
|---|