C20H26N4O3S2 — CID 55805860
N-[2-[[2-[2-[(2-thiophen-2-ylacetyl)amino]-1,3-thiazol-4-yl]acetyl]amino]ethyl]cyclohexanecarboxamide (PubChem CID 55805860) has the molecular formula C20H26N4O3S2 and a molecular weight of 434.59 g/mol. Its IUPAC name is N-[2-[[2-[2-[(2-thiophen-2-ylacetyl)amino]-1,3-thiazol-4-yl]acetyl]amino]ethyl]cyclohexanecarboxamide.
| Compound Name | N-[2-[[2-[2-[(2-thiophen-2-ylacetyl)amino]-1,3-thiazol-4-yl]acetyl]amino]ethyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 55805860 |
| Molecular Formula | C20H26N4O3S2 |
| Molecular Weight | 434.59 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | N-[2-[[2-[2-[(2-thiophen-2-ylacetyl)amino]-1,3-thiazol-4-yl]acetyl]amino]ethyl]cyclohexanecarboxamide |
| SMILES | O=C(Cc1csc(NC(=O)Cc2cccs2)n1)NCCNC(=O)C1CCCCC1 |
| InChI | InChI=1S/C20H26N4O3S2/c25-17(21-8-9-22-19(27)14-5-2-1-3-6-14)11-15-13-29-20(23-15)24-18(26)12-16-7-4-10-28-16/h4,7,10,13-14H,1-3,5-6,8-9,11-12H2,(H,21,25)(H,22,27)(H,23,24,26) |
| InChIKey | GITYSDCJLYZIJG-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.59 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_E(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|