C21H18N4O2S3 — CID 55843339
N-[4-[2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)methylamino]ethyl]-1,3-thiazol-2-yl]-2-thiophen-2-ylacetamide (PubChem CID 55843339) has the molecular formula C21H18N4O2S3 and a molecular weight of 454.60 g/mol. Its IUPAC name is N-[4-[2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)methylamino]ethyl]-1,3-thiazol-2-yl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[4-[2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)methylamino]ethyl]-1,3-thiazol-2-yl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 55843339 |
| Molecular Formula | C21H18N4O2S3 |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.06 |
| IUPAC Name | N-[4-[2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)methylamino]ethyl]-1,3-thiazol-2-yl]-2-thiophen-2-ylacetamide |
| SMILES | O=C(Cc1csc(NC(=O)Cc2cccs2)n1)NCc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C21H18N4O2S3/c26-18(22-11-20-24-17(13-29-20)14-5-2-1-3-6-14)9-15-12-30-21(23-15)25-19(27)10-16-7-4-8-28-16/h1-8,12-13H,9-11H2,(H,22,26)(H,23,25,27) |
| InChIKey | ILZKNDPHMWFUKC-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_E(2)', 'substructure': 'N/A'} |
|---|