C25H23N3O3S2 — CID 55651041
N-[4-[2-oxo-2-[(4-phenylmethoxyphenyl)methylamino]ethyl]-1,3-thiazol-2-yl]-2-thiophen-2-ylacetamide (PubChem CID 55651041) has the molecular formula C25H23N3O3S2 and a molecular weight of 477.61 g/mol. Its IUPAC name is N-[4-[2-oxo-2-[(4-phenylmethoxyphenyl)methylamino]ethyl]-1,3-thiazol-2-yl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[4-[2-oxo-2-[(4-phenylmethoxyphenyl)methylamino]ethyl]-1,3-thiazol-2-yl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 55651041 |
| Molecular Formula | C25H23N3O3S2 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | N-[4-[2-oxo-2-[(4-phenylmethoxyphenyl)methylamino]ethyl]-1,3-thiazol-2-yl]-2-thiophen-2-ylacetamide |
| SMILES | O=C(Cc1csc(NC(=O)Cc2cccs2)n1)NCc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H23N3O3S2/c29-23(13-20-17-33-25(27-20)28-24(30)14-22-7-4-12-32-22)26-15-18-8-10-21(11-9-18)31-16-19-5-2-1-3-6-19/h1-12,17H,13-16H2,(H,26,29)(H,27,28,30) |
| InChIKey | UHMCJKMZEAPLGJ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_E(2)', 'substructure': 'N/A'} |
|---|