C23H26N4O3S2 — CID 55798429
N-butan-2-yl-3-[[[2-[2-[(2-thiophen-2-ylacetyl)amino]-1,3-thiazol-4-yl]acetyl]amino]methyl]benzamide (PubChem CID 55798429) has the molecular formula C23H26N4O3S2 and a molecular weight of 470.62 g/mol. Its IUPAC name is N-butan-2-yl-3-[[[2-[2-[(2-thiophen-2-ylacetyl)amino]-1,3-thiazol-4-yl]acetyl]amino]methyl]benzamide.
| Compound Name | N-butan-2-yl-3-[[[2-[2-[(2-thiophen-2-ylacetyl)amino]-1,3-thiazol-4-yl]acetyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 55798429 |
| Molecular Formula | C23H26N4O3S2 |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | N-butan-2-yl-3-[[[2-[2-[(2-thiophen-2-ylacetyl)amino]-1,3-thiazol-4-yl]acetyl]amino]methyl]benzamide |
| SMILES | CCC(C)NC(=O)c1cccc(CNC(=O)Cc2csc(NC(=O)Cc3cccs3)n2)c1 |
| InChI | InChI=1S/C23H26N4O3S2/c1-3-15(2)25-22(30)17-7-4-6-16(10-17)13-24-20(28)11-18-14-32-23(26-18)27-21(29)12-19-8-5-9-31-19/h4-10,14-15H,3,11-13H2,1-2H3,(H,24,28)(H,25,30)(H,26,27,29) |
| InChIKey | DSFJIGVCBDYEMK-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_E(2)', 'substructure': 'N/A'} |
|---|