C22H24N4O2S2 — CID 55677053
N-[4-[2-oxo-2-[2-(pyrrolidin-1-ylmethyl)anilino]ethyl]-1,3-thiazol-2-yl]-2-thiophen-2-ylacetamide (PubChem CID 55677053) has the molecular formula C22H24N4O2S2 and a molecular weight of 440.59 g/mol. Its IUPAC name is N-[4-[2-oxo-2-[2-(pyrrolidin-1-ylmethyl)anilino]ethyl]-1,3-thiazol-2-yl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[4-[2-oxo-2-[2-(pyrrolidin-1-ylmethyl)anilino]ethyl]-1,3-thiazol-2-yl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 55677053 |
| Molecular Formula | C22H24N4O2S2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | N-[4-[2-oxo-2-[2-(pyrrolidin-1-ylmethyl)anilino]ethyl]-1,3-thiazol-2-yl]-2-thiophen-2-ylacetamide |
| SMILES | O=C(Cc1cccs1)Nc1nc(CC(=O)Nc2ccccc2CN2CCCC2)cs1 |
| InChI | InChI=1S/C22H24N4O2S2/c27-20(24-19-8-2-1-6-16(19)14-26-9-3-4-10-26)12-17-15-30-22(23-17)25-21(28)13-18-7-5-11-29-18/h1-2,5-8,11,15H,3-4,9-10,12-14H2,(H,24,27)(H,23,25,28) |
| InChIKey | HMOQFPJSWJULLW-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_E(2)', 'substructure': 'N/A'} |
|---|