C18H16FN3O3S2 — CID 55796754
N-[4-[2-(3-fluoro-4-methoxyanilino)-2-oxoethyl]-1,3-thiazol-2-yl]-2-thiophen-2-ylacetamide (PubChem CID 55796754) has the molecular formula C18H16FN3O3S2 and a molecular weight of 405.48 g/mol. Its IUPAC name is N-[4-[2-(3-fluoro-4-methoxyanilino)-2-oxoethyl]-1,3-thiazol-2-yl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[4-[2-(3-fluoro-4-methoxyanilino)-2-oxoethyl]-1,3-thiazol-2-yl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 55796754 |
| Molecular Formula | C18H16FN3O3S2 |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | N-[4-[2-(3-fluoro-4-methoxyanilino)-2-oxoethyl]-1,3-thiazol-2-yl]-2-thiophen-2-ylacetamide |
| SMILES | COc1ccc(NC(=O)Cc2csc(NC(=O)Cc3cccs3)n2)cc1F |
| InChI | InChI=1S/C18H16FN3O3S2/c1-25-15-5-4-11(7-14(15)19)20-16(23)8-12-10-27-18(21-12)22-17(24)9-13-3-2-6-26-13/h2-7,10H,8-9H2,1H3,(H,20,23)(H,21,22,24) |
| InChIKey | FSIPIDHKMQDJMV-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_E(2)', 'substructure': 'N/A'} |
|---|