C33H44N4O2S — CID 143464079
N-[4-amino-5-[(E)-3-[3-[(4-formylpiperidin-1-yl)methyl]phenyl]prop-2-enimidoyl]-2-methylphenyl]-2-thiophen-2-ylacetamide;ethane (PubChem CID 143464079) has the molecular formula C33H44N4O2S and a molecular weight of 560.81 g/mol. Its IUPAC name is N-[4-amino-5-[(E)-3-[3-[(4-formylpiperidin-1-yl)methyl]phenyl]prop-2-enimidoyl]-2-methylphenyl]-2-thiophen-2-ylacetamide;ethane.
| Compound Name | N-[4-amino-5-[(E)-3-[3-[(4-formylpiperidin-1-yl)methyl]phenyl]prop-2-enimidoyl]-2-methylphenyl]-2-thiophen-2-ylacetamide;ethane |
|---|---|
| PubChem CID | 143464079 |
| Molecular Formula | C33H44N4O2S |
| Molecular Weight | 560.81 g/mol |
| Exact Mass | 560.32 |
| IUPAC Name | N-[4-amino-5-[(E)-3-[3-[(4-formylpiperidin-1-yl)methyl]phenyl]prop-2-enimidoyl]-2-methylphenyl]-2-thiophen-2-ylacetamide;ethane |
| SMILES | CC.CC.[H]/N=C(\C=C\c1cccc(CN2CCC(C=O)CC2)c1)c1cc(NC(=O)Cc2cccs2)c(C)cc1N |
| InChI | InChI=1S/C29H32N4O2S.2C2H6/c1-20-14-27(31)25(17-28(20)32-29(35)16-24-6-3-13-36-24)26(30)8-7-21-4-2-5-23(15-21)18-33-11-9-22(19-34)10-12-33;2*1-2/h2-8,13-15,17,19,22,30H,9-12,16,18,31H2,1H3,(H,32,35);2*1-2H3/b8-7+,30-26+;; |
| InChIKey | DUDVAIXKAASLLB-MGLBLVHDSA-N |
| XLogP | 7.36 |
| TPSA | 99.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.81 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|