C16H22N2O2 — CID 62655914
N-(2,4-dimethylphenyl)-2-(4-formylpiperidin-1-yl)acetamide (PubChem CID 62655914) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-2-(4-formylpiperidin-1-yl)acetamide.
| Compound Name | N-(2,4-dimethylphenyl)-2-(4-formylpiperidin-1-yl)acetamide |
|---|---|
| PubChem CID | 62655914 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | N-(2,4-dimethylphenyl)-2-(4-formylpiperidin-1-yl)acetamide |
| SMILES | Cc1ccc(NC(=O)CN2CCC(C=O)CC2)c(C)c1 |
| InChI | InChI=1S/C16H22N2O2/c1-12-3-4-15(13(2)9-12)17-16(20)10-18-7-5-14(11-19)6-8-18/h3-4,9,11,14H,5-8,10H2,1-2H3,(H,17,20) |
| InChIKey | BXWDGAFBRBVATM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|