C24H37N5O7 — CID 58121003
2-[4,7-bis(carboxymethyl)-10-[2-(2,4-dimethylanilino)-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 58121003) has the molecular formula C24H37N5O7 and a molecular weight of 507.59 g/mol. Its IUPAC name is 2-[4,7-bis(carboxymethyl)-10-[2-(2,4-dimethylanilino)-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4,7-bis(carboxymethyl)-10-[2-(2,4-dimethylanilino)-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 58121003 |
| Molecular Formula | C24H37N5O7 |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.27 |
| IUPAC Name | 2-[4,7-bis(carboxymethyl)-10-[2-(2,4-dimethylanilino)-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | Cc1ccc(NC(=O)CN2CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC2)c(C)c1 |
| InChI | InChI=1S/C24H37N5O7/c1-18-3-4-20(19(2)13-18)25-21(30)14-26-5-7-27(15-22(31)32)9-11-29(17-24(35)36)12-10-28(8-6-26)16-23(33)34/h3-4,13H,5-12,14-17H2,1-2H3,(H,25,30)(H,31,32)(H,33,34)(H,35,36) |
| InChIKey | PLLOGXJAYUUUAT-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 153.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |