C19H20N3O4S2+ — CID 8800903
[2-(2-methoxy-5-nitroanilino)-2-oxoethyl]-bis(thiophen-2-ylmethyl)azanium (PubChem CID 8800903) has the molecular formula C19H20N3O4S2+ and a molecular weight of 418.52 g/mol. Its IUPAC name is [2-(2-methoxy-5-nitroanilino)-2-oxoethyl]-bis(thiophen-2-ylmethyl)azanium.
| Compound Name | [2-(2-methoxy-5-nitroanilino)-2-oxoethyl]-bis(thiophen-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 8800903 |
| Molecular Formula | C19H20N3O4S2+ |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | [2-(2-methoxy-5-nitroanilino)-2-oxoethyl]-bis(thiophen-2-ylmethyl)azanium |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)C[NH+](Cc1cccs1)Cc1cccs1 |
| InChI | InChI=1S/C19H19N3O4S2/c1-26-18-7-6-14(22(24)25)10-17(18)20-19(23)13-21(11-15-4-2-8-27-15)12-16-5-3-9-28-16/h2-10H,11-13H2,1H3,(H,20,23)/p+1 |
| InChIKey | HDTIEEAMODQPFB-UHFFFAOYSA-O |
| XLogP | 2.95 |
| TPSA | 85.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|