C11H7F3N2O — CID 80592357
1-cyano-N-(2,4,6-trifluorophenyl)cyclopropane-1-carboxamide (PubChem CID 80592357) has the molecular formula C11H7F3N2O and a molecular weight of 240.18 g/mol. Its IUPAC name is 1-cyano-N-(2,4,6-trifluorophenyl)cyclopropane-1-carboxamide.
| Compound Name | 1-cyano-N-(2,4,6-trifluorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 80592357 |
| Molecular Formula | C11H7F3N2O |
| Molecular Weight | 240.18 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 1-cyano-N-(2,4,6-trifluorophenyl)cyclopropane-1-carboxamide |
| SMILES | N#CC1(C(=O)Nc2c(F)cc(F)cc2F)CC1 |
| InChI | InChI=1S/C11H7F3N2O/c12-6-3-7(13)9(8(14)4-6)16-10(17)11(5-15)1-2-11/h3-4H,1-2H2,(H,16,17) |
| InChIKey | CUDUBDPJBXKWKI-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.18 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |