C14H14ClNO3S — CID 18139931
N-(2-chloro-4,5-dimethoxyphenyl)-2-thiophen-2-ylacetamide (PubChem CID 18139931) has the molecular formula C14H14ClNO3S and a molecular weight of 311.79 g/mol. Its IUPAC name is N-(2-chloro-4,5-dimethoxyphenyl)-2-thiophen-2-ylacetamide.
| Compound Name | N-(2-chloro-4,5-dimethoxyphenyl)-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 18139931 |
| Molecular Formula | C14H14ClNO3S |
| Molecular Weight | 311.79 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | N-(2-chloro-4,5-dimethoxyphenyl)-2-thiophen-2-ylacetamide |
| SMILES | COc1cc(Cl)c(NC(=O)Cc2cccs2)cc1OC |
| InChI | InChI=1S/C14H14ClNO3S/c1-18-12-7-10(15)11(8-13(12)19-2)16-14(17)6-9-4-3-5-20-9/h3-5,7-8H,6H2,1-2H3,(H,16,17) |
| InChIKey | VNMMEIOPJWXXAG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.79 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |